C19H20N2O4S — CID 95109018
(5R)-5-N-(1,3-benzodioxol-5-yl)-2-N,2-N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide (PubChem CID 95109018) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is (5R)-5-N-(1,3-benzodioxol-5-yl)-2-N,2-N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide.
| Compound Name | (5R)-5-N-(1,3-benzodioxol-5-yl)-2-N,2-N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 95109018 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (5R)-5-N-(1,3-benzodioxol-5-yl)-2-N,2-N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide |
| SMILES | CN(C)C(=O)c1cc2c(s1)CC[C@@H](C(=O)Nc1ccc3c(c1)OCO3)C2 |
| InChI | InChI=1S/C19H20N2O4S/c1-21(2)19(23)17-8-12-7-11(3-6-16(12)26-17)18(22)20-13-4-5-14-15(9-13)25-10-24-14/h4-5,8-9,11H,3,6-7,10H2,1-2H3,(H,20,22)/t11-/m1/s1 |
| InChIKey | IPQSUDRNBCNJSX-LLVKDONJSA-N |
| XLogP | 2.92 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |