C19H21FN2O2S — CID 95109081
(5R)-5-N-(4-fluoro-3-methylphenyl)-2-N,2-N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide (PubChem CID 95109081) has the molecular formula C19H21FN2O2S and a molecular weight of 360.45 g/mol. Its IUPAC name is (5R)-5-N-(4-fluoro-3-methylphenyl)-2-N,2-N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide.
| Compound Name | (5R)-5-N-(4-fluoro-3-methylphenyl)-2-N,2-N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 95109081 |
| Molecular Formula | C19H21FN2O2S |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (5R)-5-N-(4-fluoro-3-methylphenyl)-2-N,2-N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide |
| SMILES | Cc1cc(NC(=O)[C@@H]2CCc3sc(C(=O)N(C)C)cc3C2)ccc1F |
| InChI | InChI=1S/C19H21FN2O2S/c1-11-8-14(5-6-15(11)20)21-18(23)12-4-7-16-13(9-12)10-17(25-16)19(24)22(2)3/h5-6,8,10,12H,4,7,9H2,1-3H3,(H,21,23)/t12-/m1/s1 |
| InChIKey | ISMCBMIROKDBPW-GFCCVEGCSA-N |
| XLogP | 3.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |