C20H22F2N2O2S — CID 95108703
(5S)-5-N-(2,4-difluorophenyl)-2-N,2-N-diethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide (PubChem CID 95108703) has the molecular formula C20H22F2N2O2S and a molecular weight of 392.47 g/mol. Its IUPAC name is (5S)-5-N-(2,4-difluorophenyl)-2-N,2-N-diethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide.
| Compound Name | (5S)-5-N-(2,4-difluorophenyl)-2-N,2-N-diethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 95108703 |
| Molecular Formula | C20H22F2N2O2S |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (5S)-5-N-(2,4-difluorophenyl)-2-N,2-N-diethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1cc2c(s1)CC[C@H](C(=O)Nc1ccc(F)cc1F)C2 |
| InChI | InChI=1S/C20H22F2N2O2S/c1-3-24(4-2)20(26)18-10-13-9-12(5-8-17(13)27-18)19(25)23-16-7-6-14(21)11-15(16)22/h6-7,10-12H,3-5,8-9H2,1-2H3,(H,23,25)/t12-/m0/s1 |
| InChIKey | NJFZOEXFBSVOEJ-LBPRGKRZSA-N |
| XLogP | 4.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |