C24H28N2O4S — CID 95108643
(5S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpiperidine-1-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophene-5-carboxamide (PubChem CID 95108643) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is (5S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpiperidine-1-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophene-5-carboxamide.
| Compound Name | (5S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpiperidine-1-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophene-5-carboxamide |
|---|---|
| PubChem CID | 95108643 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (5S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpiperidine-1-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophene-5-carboxamide |
| SMILES | CC1CCN(C(=O)c2cc3c(s2)CC[C@H](C(=O)Nc2ccc4c(c2)OCCO4)C3)CC1 |
| InChI | InChI=1S/C24H28N2O4S/c1-15-6-8-26(9-7-15)24(28)22-13-17-12-16(2-5-21(17)31-22)23(27)25-18-3-4-19-20(14-18)30-11-10-29-19/h3-4,13-16H,2,5-12H2,1H3,(H,25,27)/t16-/m0/s1 |
| InChIKey | FPLPRVDHQVZIPX-INIZCTEOSA-N |
| XLogP | 4.14 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |