C21H23N3O3 — CID 113201029
N-(3,4-dimethoxyphenyl)-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-8-carboxamide (PubChem CID 113201029) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-8-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-8-carboxamide |
|---|---|
| PubChem CID | 113201029 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-8-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCc3nc4ccc(C)cn4c3C2)cc1OC |
| InChI | InChI=1S/C21H23N3O3/c1-13-4-9-20-23-16-7-5-14(10-17(16)24(20)12-13)21(25)22-15-6-8-18(26-2)19(11-15)27-3/h4,6,8-9,11-12,14H,5,7,10H2,1-3H3,(H,22,25) |
| InChIKey | JLAXMHUKMIHYTR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |