C20H21N3O3 — CID 113200838
N-(2,4-dimethoxyphenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-8-carboxamide (PubChem CID 113200838) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-8-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-8-carboxamide |
|---|---|
| PubChem CID | 113200838 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-8-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCc3nc4ccccn4c3C2)c(OC)c1 |
| InChI | InChI=1S/C20H21N3O3/c1-25-14-7-9-16(18(12-14)26-2)22-20(24)13-6-8-15-17(11-13)23-10-4-3-5-19(23)21-15/h3-5,7,9-10,12-13H,6,8,11H2,1-2H3,(H,22,24) |
| InChIKey | LWVLYIMKSDYIBA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |