C18H14F3N3O — CID 113200893
N-(2,3,4-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-8-carboxamide (PubChem CID 113200893) has the molecular formula C18H14F3N3O and a molecular weight of 345.32 g/mol. Its IUPAC name is N-(2,3,4-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-8-carboxamide.
| Compound Name | N-(2,3,4-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-8-carboxamide |
|---|---|
| PubChem CID | 113200893 |
| Molecular Formula | C18H14F3N3O |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-(2,3,4-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-8-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)C1CCc2nc3ccccn3c2C1 |
| InChI | InChI=1S/C18H14F3N3O/c19-11-5-7-13(17(21)16(11)20)23-18(25)10-4-6-12-14(9-10)24-8-2-1-3-15(24)22-12/h1-3,5,7-8,10H,4,6,9H2,(H,23,25) |
| InChIKey | AULLVNDATPDUCK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|