C14H17N3OS2 — CID 110680812
N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide (PubChem CID 110680812) has the molecular formula C14H17N3OS2 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 110680812 |
| Molecular Formula | C14H17N3OS2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide |
| SMILES | Cc1nc2c(s1)CC(C(=O)Nc1nc(C)c(C)s1)CC2 |
| InChI | InChI=1S/C14H17N3OS2/c1-7-8(2)19-14(15-7)17-13(18)10-4-5-11-12(6-10)20-9(3)16-11/h10H,4-6H2,1-3H3,(H,15,17,18) |
| InChIKey | MJOQYHPIPPGTGT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |