C18H23N3O — CID 22611246
N-[6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]cyclopropanecarboxamide (PubChem CID 22611246) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 22611246 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-[6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]cyclopropanecarboxamide |
| SMILES | CN(C)C1CCc2[nH]c3ccc(NC(=O)C4CC4)cc3c2C1 |
| InChI | InChI=1S/C18H23N3O/c1-21(2)13-6-8-17-15(10-13)14-9-12(5-7-16(14)20-17)19-18(22)11-3-4-11/h5,7,9,11,13,20H,3-4,6,8,10H2,1-2H3,(H,19,22) |
| InChIKey | SRAVJKYVXWRXIZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|