C22H23FN2O — CID 113203754
6-fluoro-N-(3-phenylpropyl)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide (PubChem CID 113203754) has the molecular formula C22H23FN2O and a molecular weight of 350.44 g/mol. Its IUPAC name is 6-fluoro-N-(3-phenylpropyl)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide.
| Compound Name | 6-fluoro-N-(3-phenylpropyl)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 113203754 |
| Molecular Formula | C22H23FN2O |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 6-fluoro-N-(3-phenylpropyl)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C22H23FN2O/c23-17-9-11-21-19(14-17)18-13-16(8-10-20(18)25-21)22(26)24-12-4-7-15-5-2-1-3-6-15/h1-3,5-6,9,11,14,16,25H,4,7-8,10,12-13H2,(H,24,26) |
| InChIKey | MLXVEQGESZLVHM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|