C13H17IN4Pt-3 — CID 155634879
2-azanidylethylazanide;iodoplatinum;1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ide (PubChem CID 155634879) has the molecular formula C13H17IN4Pt-3 and a molecular weight of 551.29 g/mol. Its IUPAC name is 2-azanidylethylazanide;iodoplatinum;1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ide.
| Compound Name | 2-azanidylethylazanide;iodoplatinum;1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ide |
|---|---|
| PubChem CID | 155634879 |
| Molecular Formula | C13H17IN4Pt-3 |
| Molecular Weight | 551.29 g/mol |
| Exact Mass | 551.02 |
| IUPAC Name | 2-azanidylethylazanide;iodoplatinum;1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ide |
| SMILES | I[Pt].[NH-]CC[NH-].c1ccc2c3c([nH]c2c1)C[N-]CC3 |
| InChI | InChI=1S/C11H11N2.C2H6N2.HI.Pt/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10;3-1-2-4;;/h1-4,13H,5-7H2;3-4H,1-2H2;1H;/q-1;-2;;+1/p-1 |
| InChIKey | SMYYCKJQXWWUQR-UHFFFAOYSA-M |
| XLogP | 4.57 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|