C21H26N2O3 — CID 142183147
anisole;ethyl formate;2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 142183147) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is anisole;ethyl formate;2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | anisole;ethyl formate;2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 142183147 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | anisole;ethyl formate;2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | CCOC=O.COc1ccccc1.c1ccc2c3c([nH]c2c1)CNCC3 |
| InChI | InChI=1S/C11H12N2.C7H8O.C3H6O2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10;1-8-7-5-3-2-4-6-7;1-2-5-3-4/h1-4,12-13H,5-7H2;2-6H,1H3;3H,2H2,1H3 |
| InChIKey | XMTRBVPJUPKBKM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|