C22H26N2O3 — CID 159500765
2-[2-(4-methoxyphenyl)-1H-indol-3-yl]acetic acid;piperidine (PubChem CID 159500765) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)-1H-indol-3-yl]acetic acid;piperidine.
| Compound Name | 2-[2-(4-methoxyphenyl)-1H-indol-3-yl]acetic acid;piperidine |
|---|---|
| PubChem CID | 159500765 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)-1H-indol-3-yl]acetic acid;piperidine |
| SMILES | C1CCNCC1.COc1ccc(-c2[nH]c3ccccc3c2CC(=O)O)cc1 |
| InChI | InChI=1S/C17H15NO3.C5H11N/c1-21-12-8-6-11(7-9-12)17-14(10-16(19)20)13-4-2-3-5-15(13)18-17;1-2-4-6-5-3-1/h2-9,18H,10H2,1H3,(H,19,20);6H,1-5H2 |
| InChIKey | LZIZXJPHCBLXAR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |