C25H20N4O — CID 141136735
[1-(1H-indol-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-pyridin-4-ylmethanone (PubChem CID 141136735) has the molecular formula C25H20N4O and a molecular weight of 392.46 g/mol. Its IUPAC name is [1-(1H-indol-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-pyridin-4-ylmethanone.
| Compound Name | [1-(1H-indol-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 141136735 |
| Molecular Formula | C25H20N4O |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [1-(1H-indol-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1CCc2c([nH]c3ccccc23)C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H20N4O/c30-25(16-9-12-26-13-10-16)29-14-11-19-17-5-2-4-8-22(17)28-23(19)24(29)20-15-27-21-7-3-1-6-18(20)21/h1-10,12-13,15,24,27-28H,11,14H2 |
| InChIKey | PZTUNQJZFFMNOV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|