C28H24N4O2 — CID 45169883
2-methyl-4-[1-(2-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]phthalazin-1-one (PubChem CID 45169883) has the molecular formula C28H24N4O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 2-methyl-4-[1-(2-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]phthalazin-1-one.
| Compound Name | 2-methyl-4-[1-(2-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]phthalazin-1-one |
|---|---|
| PubChem CID | 45169883 |
| Molecular Formula | C28H24N4O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 2-methyl-4-[1-(2-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]phthalazin-1-one |
| SMILES | Cc1ccccc1C1c2[nH]c3ccccc3c2CCN1C(=O)c1nn(C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C28H24N4O2/c1-17-9-3-4-10-18(17)26-24-21(19-11-7-8-14-23(19)29-24)15-16-32(26)28(34)25-20-12-5-6-13-22(20)27(33)31(2)30-25/h3-14,26,29H,15-16H2,1-2H3 |
| InChIKey | IKGMQOVBWGLAJS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|