C22H20N4O2 — CID 99755073
3-methyl-4-oxo-N-[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]phthalazine-1-carboxamide (PubChem CID 99755073) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 3-methyl-4-oxo-N-[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]phthalazine-1-carboxamide.
| Compound Name | 3-methyl-4-oxo-N-[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 99755073 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 3-methyl-4-oxo-N-[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]phthalazine-1-carboxamide |
| SMILES | Cn1nc(C(=O)N[C@@H]2CCCc3c2[nH]c2ccccc32)c2ccccc2c1=O |
| InChI | InChI=1S/C22H20N4O2/c1-26-22(28)16-9-3-2-8-15(16)20(25-26)21(27)24-18-12-6-10-14-13-7-4-5-11-17(13)23-19(14)18/h2-5,7-9,11,18,23H,6,10,12H2,1H3,(H,24,27)/t18-/m1/s1 |
| InChIKey | ZYBAHGAULFDRSI-GOSISDBHSA-N |
| XLogP | 3.22 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|