C19H23ClN2 — CID 169319952
(1R,15S,17S)-7-chloro-17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene (PubChem CID 169319952) has the molecular formula C19H23ClN2 and a molecular weight of 314.86 g/mol. Its IUPAC name is (1R,15S,17S)-7-chloro-17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene.
| Compound Name | (1R,15S,17S)-7-chloro-17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene |
|---|---|
| PubChem CID | 169319952 |
| Molecular Formula | C19H23ClN2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (1R,15S,17S)-7-chloro-17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene |
| SMILES | CC[C@H]1C[C@H]2C[C@H]3c4[nH]c5ccc(Cl)cc5c4CCN(C2)C13 |
| InChI | InChI=1S/C19H23ClN2/c1-2-12-7-11-8-16-18-14(5-6-22(10-11)19(12)16)15-9-13(20)3-4-17(15)21-18/h3-4,9,11-12,16,19,21H,2,5-8,10H2,1H3/t11-,12-,16-,19?/m0/s1 |
| InChIKey | ZLXKJEFXAYEFEX-RQFXSRDHSA-N |
| XLogP | 4.58 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |