C20H23N3 — CID 172506249
(1R,15S,17S)-17-ethyl-7-isocyano-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene (PubChem CID 172506249) has the molecular formula C20H23N3 and a molecular weight of 305.42 g/mol. Its IUPAC name is (1R,15S,17S)-17-ethyl-7-isocyano-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene.
| Compound Name | (1R,15S,17S)-17-ethyl-7-isocyano-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene |
|---|---|
| PubChem CID | 172506249 |
| Molecular Formula | C20H23N3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | (1R,15S,17S)-17-ethyl-7-isocyano-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene |
| SMILES | [C-]#[N+]c1ccc2[nH]c3c(c2c1)CCN1C[C@H]2C[C@H](CC)C1[C@H]3C2 |
| InChI | InChI=1S/C20H23N3/c1-3-13-8-12-9-17-19-15(6-7-23(11-12)20(13)17)16-10-14(21-2)4-5-18(16)22-19/h4-5,10,12-13,17,20,22H,3,6-9,11H2,1H3/t12-,13-,17-,20?/m0/s1 |
| InChIKey | HZOWYBMGGPLZSV-CICBKQEESA-N |
| XLogP | 4.48 |
| TPSA | 23.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|