C19H25N3 — CID 172506215
17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraen-7-amine (PubChem CID 172506215) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is 17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraen-7-amine.
| Compound Name | 17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraen-7-amine |
|---|---|
| PubChem CID | 172506215 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraen-7-amine |
| SMILES | CCC1CC2CC3c4[nH]c5ccc(N)cc5c4CCN(C2)C13 |
| InChI | InChI=1S/C19H25N3/c1-2-12-7-11-8-16-18-14(5-6-22(10-11)19(12)16)15-9-13(20)3-4-17(15)21-18/h3-4,9,11-12,16,19,21H,2,5-8,10,20H2,1H3 |
| InChIKey | IAJMFUMYDHYRHT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|