C29H31ClN2O3 — CID 143312894
1-[7-chloro-1-(4-methoxyphenyl)-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indol-2-yl]-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxypropan-1-one (PubChem CID 143312894) has the molecular formula C29H31ClN2O3 and a molecular weight of 491.03 g/mol. Its IUPAC name is 1-[7-chloro-1-(4-methoxyphenyl)-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indol-2-yl]-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxypropan-1-one.
| Compound Name | 1-[7-chloro-1-(4-methoxyphenyl)-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indol-2-yl]-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxypropan-1-one |
|---|---|
| PubChem CID | 143312894 |
| Molecular Formula | C29H31ClN2O3 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 1-[7-chloro-1-(4-methoxyphenyl)-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indol-2-yl]-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxypropan-1-one |
| SMILES | C=C/C=C\C=C(/C)OC(C)C(=O)N1CCCc2c([nH]c3ccc(Cl)cc23)C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C29H31ClN2O3/c1-5-6-7-9-19(2)35-20(3)29(33)32-17-8-10-24-25-18-22(30)13-16-26(25)31-27(24)28(32)21-11-14-23(34-4)15-12-21/h5-7,9,11-16,18,20,28,31H,1,8,10,17H2,2-4H3/b7-6-,19-9+ |
| InChIKey | DBXUVTDAOSRMBF-FHBISDMASA-N |
| XLogP | 6.75 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|