C19H21ClN2O2 — CID 53306125
4-(6-ethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)benzene-1,2-diol;hydrochloride (PubChem CID 53306125) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is 4-(6-ethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)benzene-1,2-diol;hydrochloride.
| Compound Name | 4-(6-ethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)benzene-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 53306125 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-(6-ethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)benzene-1,2-diol;hydrochloride |
| SMILES | CCc1ccc2[nH]c3c(c2c1)CCNC3c1ccc(O)c(O)c1.Cl |
| InChI | InChI=1S/C19H20N2O2.ClH/c1-2-11-3-5-15-14(9-11)13-7-8-20-18(19(13)21-15)12-4-6-16(22)17(23)10-12;/h3-6,9-10,18,20-23H,2,7-8H2,1H3;1H |
| InChIKey | QBCZYDYFESXRHH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|