C17H15N3O4 — CID 135059885
1-(4-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-6,7-diol (PubChem CID 135059885) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-6,7-diol.
| Compound Name | 1-(4-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-6,7-diol |
|---|---|
| PubChem CID | 135059885 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-(4-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-6,7-diol |
| SMILES | O=[N+]([O-])c1ccc(C2NCCc3c2[nH]c2cc(O)c(O)cc32)cc1 |
| InChI | InChI=1S/C17H15N3O4/c21-14-7-12-11-5-6-18-16(17(11)19-13(12)8-15(14)22)9-1-3-10(4-2-9)20(23)24/h1-4,7-8,16,18-19,21-22H,5-6H2 |
| InChIKey | QQBRXOOTGUTDIX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 111.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|