C16H17ClN2S — CID 145496008
6-chloro-1-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 145496008) has the molecular formula C16H17ClN2S and a molecular weight of 304.85 g/mol. Its IUPAC name is 6-chloro-1-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 6-chloro-1-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 145496008 |
| Molecular Formula | C16H17ClN2S |
| Molecular Weight | 304.85 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 6-chloro-1-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | C=C/C=C(\SC)C1NCCc2c1[nH]c1ccc(Cl)cc21 |
| InChI | InChI=1S/C16H17ClN2S/c1-3-4-14(20-2)16-15-11(7-8-18-16)12-9-10(17)5-6-13(12)19-15/h3-6,9,16,18-19H,1,7-8H2,2H3/b14-4- |
| InChIKey | JMMZGXMCVOHMPH-CPSFFCFKSA-N |
| XLogP | 4.44 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|