C20H23ClN2 — CID 143536063
6-chloro-1-[(3E)-3-ethenyl-2-methylhexa-3,5-dienyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 143536063) has the molecular formula C20H23ClN2 and a molecular weight of 326.87 g/mol. Its IUPAC name is 6-chloro-1-[(3E)-3-ethenyl-2-methylhexa-3,5-dienyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 6-chloro-1-[(3E)-3-ethenyl-2-methylhexa-3,5-dienyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 143536063 |
| Molecular Formula | C20H23ClN2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 6-chloro-1-[(3E)-3-ethenyl-2-methylhexa-3,5-dienyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | C=C/C=C(\C=C)C(C)CC1NCCc2c1[nH]c1ccc(Cl)cc21 |
| InChI | InChI=1S/C20H23ClN2/c1-4-6-14(5-2)13(3)11-19-20-16(9-10-22-19)17-12-15(21)7-8-18(17)23-20/h4-8,12-13,19,22-23H,1-2,9-11H2,3H3/b14-6+ |
| InChIKey | DWDBODMFVDHANG-MKMNVTDBSA-N |
| XLogP | 5.33 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|