C21H17ClN4O3 — CID 1427764
1-(2-chlorophenyl)-6-hydroxy-5-[(1R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]pyrimidine-2,4-dione (PubChem CID 1427764) has the molecular formula C21H17ClN4O3 and a molecular weight of 408.85 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-6-hydroxy-5-[(1R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]pyrimidine-2,4-dione.
| Compound Name | 1-(2-chlorophenyl)-6-hydroxy-5-[(1R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 1427764 |
| Molecular Formula | C21H17ClN4O3 |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 1-(2-chlorophenyl)-6-hydroxy-5-[(1R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccccc2Cl)c(O)c1[C@H]1NCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C21H17ClN4O3/c22-13-6-2-4-8-15(13)26-20(28)16(19(27)25-21(26)29)18-17-12(9-10-23-18)11-5-1-3-7-14(11)24-17/h1-8,18,23-24,28H,9-10H2,(H,25,27,29)/t18-/m1/s1 |
| InChIKey | UBDOXIQLKKOZSS-GOSISDBHSA-N |
| XLogP | 2.60 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|