C24H24N4O5 — CID 4833833
1-(2-ethoxyphenyl)-6-hydroxy-5-(6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)pyrimidine-2,4-dione (PubChem CID 4833833) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-6-hydroxy-5-(6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)pyrimidine-2,4-dione.
| Compound Name | 1-(2-ethoxyphenyl)-6-hydroxy-5-(6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4833833 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 1-(2-ethoxyphenyl)-6-hydroxy-5-(6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)pyrimidine-2,4-dione |
| SMILES | CCOc1ccccc1-n1c(O)c(C2NCCc3c2[nH]c2ccc(OC)cc32)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H24N4O5/c1-3-33-18-7-5-4-6-17(18)28-23(30)19(22(29)27-24(28)31)21-20-14(10-11-25-21)15-12-13(32-2)8-9-16(15)26-20/h4-9,12,21,25-26,30H,3,10-11H2,1-2H3,(H,27,29,31) |
| InChIKey | UKAUGLLUWJOJOY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|