C24H24N4O5 — CID 4964566
1-(2,5-dimethoxyphenyl)-6-hydroxy-5-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)pyrimidine-2,4-dione (PubChem CID 4964566) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-6-hydroxy-5-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)pyrimidine-2,4-dione.
| Compound Name | 1-(2,5-dimethoxyphenyl)-6-hydroxy-5-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4964566 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-6-hydroxy-5-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)pyrimidine-2,4-dione |
| SMILES | COc1ccc(OC)c(-n2c(O)c(C3c4[nH]c5ccccc5c4CCN3C)c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C24H24N4O5/c1-27-11-10-15-14-6-4-5-7-16(14)25-20(15)21(27)19-22(29)26-24(31)28(23(19)30)17-12-13(32-2)8-9-18(17)33-3/h4-9,12,21,25,30H,10-11H2,1-3H3,(H,26,29,31) |
| InChIKey | QHFQOVXEQAHZIT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|