C23H30N4O3 — CID 4965768
6-hydroxy-1,3-bis(2-methylpropyl)-5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)pyrimidine-2,4-dione (PubChem CID 4965768) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 6-hydroxy-1,3-bis(2-methylpropyl)-5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1,3-bis(2-methylpropyl)-5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4965768 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 6-hydroxy-1,3-bis(2-methylpropyl)-5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)pyrimidine-2,4-dione |
| SMILES | CC(C)Cn1c(O)c(C2NCCc3c2[nH]c2ccccc32)c(=O)n(CC(C)C)c1=O |
| InChI | InChI=1S/C23H30N4O3/c1-13(2)11-26-21(28)18(22(29)27(23(26)30)12-14(3)4)20-19-16(9-10-24-20)15-7-5-6-8-17(15)25-19/h5-8,13-14,20,24-25,28H,9-12H2,1-4H3 |
| InChIKey | QTGZPFITSJCCAH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|