C20H22N4O2S — CID 135795894
3-ethyl-6-hydroxy-2-prop-2-enylsulfanyl-5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)pyrimidin-4-one (PubChem CID 135795894) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 3-ethyl-6-hydroxy-2-prop-2-enylsulfanyl-5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)pyrimidin-4-one.
| Compound Name | 3-ethyl-6-hydroxy-2-prop-2-enylsulfanyl-5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)pyrimidin-4-one |
|---|---|
| PubChem CID | 135795894 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 3-ethyl-6-hydroxy-2-prop-2-enylsulfanyl-5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)pyrimidin-4-one |
| SMILES | C=CCSc1nc(O)c(C2NCCc3c2[nH]c2ccccc32)c(=O)n1CC |
| InChI | InChI=1S/C20H22N4O2S/c1-3-11-27-20-23-18(25)15(19(26)24(20)4-2)17-16-13(9-10-21-17)12-7-5-6-8-14(12)22-16/h3,5-8,17,21-22,25H,1,4,9-11H2,2H3 |
| InChIKey | WIVSOTHFVMCVPA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|