C20H19N3O3S — CID 3402133
6-hydroxy-1-(4-methoxyphenyl)-2-sulfanylidene-5-(1,2,3,4-tetrahydroisoquinolin-1-yl)pyrimidin-4-one (PubChem CID 3402133) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is 6-hydroxy-1-(4-methoxyphenyl)-2-sulfanylidene-5-(1,2,3,4-tetrahydroisoquinolin-1-yl)pyrimidin-4-one.
| Compound Name | 6-hydroxy-1-(4-methoxyphenyl)-2-sulfanylidene-5-(1,2,3,4-tetrahydroisoquinolin-1-yl)pyrimidin-4-one |
|---|---|
| PubChem CID | 3402133 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 6-hydroxy-1-(4-methoxyphenyl)-2-sulfanylidene-5-(1,2,3,4-tetrahydroisoquinolin-1-yl)pyrimidin-4-one |
| SMILES | COc1ccc(-n2c(O)c(C3NCCc4ccccc43)c(=O)[nH]c2=S)cc1 |
| InChI | InChI=1S/C20H19N3O3S/c1-26-14-8-6-13(7-9-14)23-19(25)16(18(24)22-20(23)27)17-15-5-3-2-4-12(15)10-11-21-17/h2-9,17,21,25H,10-11H2,1H3,(H,22,24,27) |
| InChIKey | IDTOQBFFQJZMSQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|