C17H18N2O2 — CID 919612
3-(4-methoxyphenyl)-2,2-dimethyl-1H-quinazolin-4-one (PubChem CID 919612) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2,2-dimethyl-1H-quinazolin-4-one.
| Compound Name | 3-(4-methoxyphenyl)-2,2-dimethyl-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 919612 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-(4-methoxyphenyl)-2,2-dimethyl-1H-quinazolin-4-one |
| SMILES | COc1ccc(N2C(=O)c3ccccc3NC2(C)C)cc1 |
| InChI | InChI=1S/C17H18N2O2/c1-17(2)18-15-7-5-4-6-14(15)16(20)19(17)12-8-10-13(21-3)11-9-12/h4-11,18H,1-3H3 |
| InChIKey | RPLFBIOEIFQSEL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |