C21H19NO5 — CID 135638390
3-[(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)iminomethyl]-4-hydroxychromen-2-one (PubChem CID 135638390) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is 3-[(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)iminomethyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)iminomethyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 135638390 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 3-[(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)iminomethyl]-4-hydroxychromen-2-one |
| SMILES | COc1cc2c(cc1OC)C(/N=C/c1c(O)c3ccccc3oc1=O)CC2 |
| InChI | InChI=1S/C21H19NO5/c1-25-18-9-12-7-8-16(14(12)10-19(18)26-2)22-11-15-20(23)13-5-3-4-6-17(13)27-21(15)24/h3-6,9-11,16,23H,7-8H2,1-2H3/b22-11+ |
| InChIKey | CMSNZQHFQIYVSB-SSDVNMTOSA-N |
| XLogP | 3.62 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|