C29H33NO6 — CID 43949028
4-[[2-(2-cyclohexylacetyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]chromen-2-one (PubChem CID 43949028) has the molecular formula C29H33NO6 and a molecular weight of 491.58 g/mol. Its IUPAC name is 4-[[2-(2-cyclohexylacetyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]chromen-2-one.
| Compound Name | 4-[[2-(2-cyclohexylacetyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]chromen-2-one |
|---|---|
| PubChem CID | 43949028 |
| Molecular Formula | C29H33NO6 |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 4-[[2-(2-cyclohexylacetyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]chromen-2-one |
| SMILES | COc1cc2c(cc1OC)C(COc1cc(=O)oc3ccccc13)N(C(=O)CC1CCCCC1)CC2 |
| InChI | InChI=1S/C29H33NO6/c1-33-26-15-20-12-13-30(28(31)14-19-8-4-3-5-9-19)23(22(20)16-27(26)34-2)18-35-25-17-29(32)36-24-11-7-6-10-21(24)25/h6-7,10-11,15-17,19,23H,3-5,8-9,12-14,18H2,1-2H3 |
| InChIKey | REWHFLWDUQSLIN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|