C34H31NO6 — CID 43948964
7-[[6,7-dimethoxy-2-(2-naphthalen-1-ylacetyl)-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]-4-methylchromen-2-one (PubChem CID 43948964) has the molecular formula C34H31NO6 and a molecular weight of 549.62 g/mol. Its IUPAC name is 7-[[6,7-dimethoxy-2-(2-naphthalen-1-ylacetyl)-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]-4-methylchromen-2-one.
| Compound Name | 7-[[6,7-dimethoxy-2-(2-naphthalen-1-ylacetyl)-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 43948964 |
| Molecular Formula | C34H31NO6 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 7-[[6,7-dimethoxy-2-(2-naphthalen-1-ylacetyl)-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]-4-methylchromen-2-one |
| SMILES | COc1cc2c(cc1OC)C(COc1ccc3c(C)cc(=O)oc3c1)N(C(=O)Cc1cccc3ccccc13)CC2 |
| InChI | InChI=1S/C34H31NO6/c1-21-15-34(37)41-30-18-25(11-12-26(21)30)40-20-29-28-19-32(39-3)31(38-2)16-24(28)13-14-35(29)33(36)17-23-9-6-8-22-7-4-5-10-27(22)23/h4-12,15-16,18-19,29H,13-14,17,20H2,1-3H3 |
| InChIKey | JTJXVJHFNMZWPR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|