C31H29NO6 — CID 2158182
7-[[(1S)-6,7-dimethoxy-2-[(E)-3-phenylprop-2-enoyl]-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]-4-methylchromen-2-one (PubChem CID 2158182) has the molecular formula C31H29NO6 and a molecular weight of 511.57 g/mol. Its IUPAC name is 7-[[(1S)-6,7-dimethoxy-2-[(E)-3-phenylprop-2-enoyl]-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]-4-methylchromen-2-one.
| Compound Name | 7-[[(1S)-6,7-dimethoxy-2-[(E)-3-phenylprop-2-enoyl]-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 2158182 |
| Molecular Formula | C31H29NO6 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 7-[[(1S)-6,7-dimethoxy-2-[(E)-3-phenylprop-2-enoyl]-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]-4-methylchromen-2-one |
| SMILES | COc1cc2c(cc1OC)[C@@H](COc1ccc3c(C)cc(=O)oc3c1)N(C(=O)/C=C/c1ccccc1)CC2 |
| InChI | InChI=1S/C31H29NO6/c1-20-15-31(34)38-27-17-23(10-11-24(20)27)37-19-26-25-18-29(36-3)28(35-2)16-22(25)13-14-32(26)30(33)12-9-21-7-5-4-6-8-21/h4-12,15-18,26H,13-14,19H2,1-3H3/b12-9+/t26-/m1/s1 |
| InChIKey | PQRXTCNZOUHNNT-CJVCNUQRSA-N |
| XLogP | 5.34 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|