C27H25NO6S — CID 5186808
7-[[6,7-dimethoxy-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]-4-methylchromen-2-one (PubChem CID 5186808) has the molecular formula C27H25NO6S and a molecular weight of 491.57 g/mol. Its IUPAC name is 7-[[6,7-dimethoxy-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]-4-methylchromen-2-one.
| Compound Name | 7-[[6,7-dimethoxy-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 5186808 |
| Molecular Formula | C27H25NO6S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 7-[[6,7-dimethoxy-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]-4-methylchromen-2-one |
| SMILES | COc1cc2c(cc1OC)C(COc1ccc3c(C)cc(=O)oc3c1)N(C(=O)c1cccs1)CC2 |
| InChI | InChI=1S/C27H25NO6S/c1-16-11-26(29)34-22-13-18(6-7-19(16)22)33-15-21-20-14-24(32-3)23(31-2)12-17(20)8-9-28(21)27(30)25-5-4-10-35-25/h4-7,10-14,21H,8-9,15H2,1-3H3 |
| InChIKey | MXROWBCKQINANC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|