C27H26FNO4 — CID 6162212
(E)-1-[1-[(4-fluorophenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-3-phenylprop-2-en-1-one (PubChem CID 6162212) has the molecular formula C27H26FNO4 and a molecular weight of 447.51 g/mol. Its IUPAC name is (E)-1-[1-[(4-fluorophenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[1-[(4-fluorophenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 6162212 |
| Molecular Formula | C27H26FNO4 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (E)-1-[1-[(4-fluorophenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-3-phenylprop-2-en-1-one |
| SMILES | COc1cc2c(cc1OC)C(COc1ccc(F)cc1)N(C(=O)/C=C/c1ccccc1)CC2 |
| InChI | InChI=1S/C27H26FNO4/c1-31-25-16-20-14-15-29(27(30)13-8-19-6-4-3-5-7-19)24(23(20)17-26(25)32-2)18-33-22-11-9-21(28)10-12-22/h3-13,16-17,24H,14-15,18H2,1-2H3/b13-8+ |
| InChIKey | TXMIDRACNKSZPW-MDWZMJQESA-N |
| XLogP | 5.06 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|