C28H23ClN2O8 — CID 43949011
4-[[2-(5-chloro-2-nitrobenzoyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]chromen-2-one (PubChem CID 43949011) has the molecular formula C28H23ClN2O8 and a molecular weight of 550.95 g/mol. Its IUPAC name is 4-[[2-(5-chloro-2-nitrobenzoyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]chromen-2-one.
| Compound Name | 4-[[2-(5-chloro-2-nitrobenzoyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]chromen-2-one |
|---|---|
| PubChem CID | 43949011 |
| Molecular Formula | C28H23ClN2O8 |
| Molecular Weight | 550.95 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | 4-[[2-(5-chloro-2-nitrobenzoyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]chromen-2-one |
| SMILES | COc1cc2c(cc1OC)C(COc1cc(=O)oc3ccccc13)N(C(=O)c1cc(Cl)ccc1[N+](=O)[O-])CC2 |
| InChI | InChI=1S/C28H23ClN2O8/c1-36-25-11-16-9-10-30(28(33)20-12-17(29)7-8-21(20)31(34)35)22(19(16)13-26(25)37-2)15-38-24-14-27(32)39-23-6-4-3-5-18(23)24/h3-8,11-14,22H,9-10,15H2,1-2H3 |
| InChIKey | QJAWSBXIUIGIEU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 121.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.95 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|