C27H27ClN2O6 — CID 23848460
(5-chloro-2-nitrophenyl)-[1-[(4-ethylphenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 23848460) has the molecular formula C27H27ClN2O6 and a molecular weight of 510.97 g/mol. Its IUPAC name is (5-chloro-2-nitrophenyl)-[1-[(4-ethylphenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | (5-chloro-2-nitrophenyl)-[1-[(4-ethylphenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 23848460 |
| Molecular Formula | C27H27ClN2O6 |
| Molecular Weight | 510.97 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | (5-chloro-2-nitrophenyl)-[1-[(4-ethylphenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | CCc1ccc(OCC2c3cc(OC)c(OC)cc3CCN2C(=O)c2cc(Cl)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H27ClN2O6/c1-4-17-5-8-20(9-6-17)36-16-24-21-15-26(35-3)25(34-2)13-18(21)11-12-29(24)27(31)22-14-19(28)7-10-23(22)30(32)33/h5-10,13-15,24H,4,11-12,16H2,1-3H3 |
| InChIKey | IKTNEIUYQVGTFS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.97 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|