C27H23NO5 — CID 24685630
3-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)chromen-2-one (PubChem CID 24685630) has the molecular formula C27H23NO5 and a molecular weight of 441.48 g/mol. Its IUPAC name is 3-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)chromen-2-one.
| Compound Name | 3-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)chromen-2-one |
|---|---|
| PubChem CID | 24685630 |
| Molecular Formula | C27H23NO5 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 3-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)chromen-2-one |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)N(C(=O)c1cc3ccccc3oc1=O)CC2 |
| InChI | InChI=1S/C27H23NO5/c1-31-23-15-18-12-13-28(25(17-8-4-3-5-9-17)20(18)16-24(23)32-2)26(29)21-14-19-10-6-7-11-22(19)33-27(21)30/h3-11,14-16,25H,12-13H2,1-2H3 |
| InChIKey | QKRRSAJAYIVFLI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|