C29H24F3NO6 — CID 43948924
3-[6,7-dimethoxy-1-[[3-(trifluoromethyl)phenoxy]methyl]-3,4-dihydro-1H-isoquinoline-2-carbonyl]chromen-2-one (PubChem CID 43948924) has the molecular formula C29H24F3NO6 and a molecular weight of 539.51 g/mol. Its IUPAC name is 3-[6,7-dimethoxy-1-[[3-(trifluoromethyl)phenoxy]methyl]-3,4-dihydro-1H-isoquinoline-2-carbonyl]chromen-2-one.
| Compound Name | 3-[6,7-dimethoxy-1-[[3-(trifluoromethyl)phenoxy]methyl]-3,4-dihydro-1H-isoquinoline-2-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 43948924 |
| Molecular Formula | C29H24F3NO6 |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 3-[6,7-dimethoxy-1-[[3-(trifluoromethyl)phenoxy]methyl]-3,4-dihydro-1H-isoquinoline-2-carbonyl]chromen-2-one |
| SMILES | COc1cc2c(cc1OC)C(COc1cccc(C(F)(F)F)c1)N(C(=O)c1cc3ccccc3oc1=O)CC2 |
| InChI | InChI=1S/C29H24F3NO6/c1-36-25-13-17-10-11-33(27(34)22-12-18-6-3-4-9-24(18)39-28(22)35)23(21(17)15-26(25)37-2)16-38-20-8-5-7-19(14-20)29(30,31)32/h3-9,12-15,23H,10-11,16H2,1-2H3 |
| InChIKey | VIPVHFJRFYZFGA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|