C26H24ClF3N2O3S — CID 44959607
N-(3-chlorophenyl)-6,7-dimethoxy-1-[[3-(trifluoromethyl)phenoxy]methyl]-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 44959607) has the molecular formula C26H24ClF3N2O3S and a molecular weight of 537.00 g/mol. Its IUPAC name is N-(3-chlorophenyl)-6,7-dimethoxy-1-[[3-(trifluoromethyl)phenoxy]methyl]-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | N-(3-chlorophenyl)-6,7-dimethoxy-1-[[3-(trifluoromethyl)phenoxy]methyl]-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 44959607 |
| Molecular Formula | C26H24ClF3N2O3S |
| Molecular Weight | 537.00 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | N-(3-chlorophenyl)-6,7-dimethoxy-1-[[3-(trifluoromethyl)phenoxy]methyl]-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | COc1cc2c(cc1OC)C(COc1cccc(C(F)(F)F)c1)N(C(=S)Nc1cccc(Cl)c1)CC2 |
| InChI | InChI=1S/C26H24ClF3N2O3S/c1-33-23-11-16-9-10-32(25(36)31-19-7-4-6-18(27)13-19)22(21(16)14-24(23)34-2)15-35-20-8-3-5-17(12-20)26(28,29)30/h3-8,11-14,22H,9-10,15H2,1-2H3,(H,31,36) |
| InChIKey | AGJPDFDWMULKSX-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.00 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|