C25H15NO6 — CID 58550666
10-amino-7-(4-hydroxy-2-oxochromen-3-yl)-7H-chromeno[3,2-c]chromen-6-one (PubChem CID 58550666) has the molecular formula C25H15NO6 and a molecular weight of 425.40 g/mol. Its IUPAC name is 10-amino-7-(4-hydroxy-2-oxochromen-3-yl)-7H-chromeno[3,2-c]chromen-6-one.
| Compound Name | 10-amino-7-(4-hydroxy-2-oxochromen-3-yl)-7H-chromeno[3,2-c]chromen-6-one |
|---|---|
| PubChem CID | 58550666 |
| Molecular Formula | C25H15NO6 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 10-amino-7-(4-hydroxy-2-oxochromen-3-yl)-7H-chromeno[3,2-c]chromen-6-one |
| SMILES | Nc1ccc2c(c1)Oc1c(c(=O)oc3ccccc13)C2c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C25H15NO6/c26-12-9-10-13-18(11-12)30-23-15-6-2-4-8-17(15)32-25(29)21(23)19(13)20-22(27)14-5-1-3-7-16(14)31-24(20)28/h1-11,19,27H,26H2 |
| InChIKey | ZDKIPJNEUFKQAZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|