C21H18O4 — CID 134830737
(10Z)-6-methoxy-12-methyl-2,20-dioxatetracyclo[11.8.0.04,9.014,19]henicosa-1(13),4(9),5,7,10,14,16,18-octaen-21-one (PubChem CID 134830737) has the molecular formula C21H18O4 and a molecular weight of 334.37 g/mol. Its IUPAC name is (10Z)-6-methoxy-12-methyl-2,20-dioxatetracyclo[11.8.0.04,9.014,19]henicosa-1(13),4(9),5,7,10,14,16,18-octaen-21-one.
| Compound Name | (10Z)-6-methoxy-12-methyl-2,20-dioxatetracyclo[11.8.0.04,9.014,19]henicosa-1(13),4(9),5,7,10,14,16,18-octaen-21-one |
|---|---|
| PubChem CID | 134830737 |
| Molecular Formula | C21H18O4 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (10Z)-6-methoxy-12-methyl-2,20-dioxatetracyclo[11.8.0.04,9.014,19]henicosa-1(13),4(9),5,7,10,14,16,18-octaen-21-one |
| SMILES | COc1ccc2c(c1)COc1c(c3ccccc3oc1=O)C(C)/C=C\2 |
| InChI | InChI=1S/C21H18O4/c1-13-7-8-14-9-10-16(23-2)11-15(14)12-24-20-19(13)17-5-3-4-6-18(17)25-21(20)22/h3-11,13H,12H2,1-2H3/b8-7- |
| InChIKey | STHIUYHSQQDRKK-FPLPWBNLSA-N |
| XLogP | 4.51 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|