C15H10O7 — CID 162812240
(6bR,10aS)-1,3,8-trihydroxy-10,10a-dihydro-6bH-[1]benzofuro[3,2-c]chromene-6,9-dione (PubChem CID 162812240) has the molecular formula C15H10O7 and a molecular weight of 302.24 g/mol. Its IUPAC name is (6bR,10aS)-1,3,8-trihydroxy-10,10a-dihydro-6bH-[1]benzofuro[3,2-c]chromene-6,9-dione.
| Compound Name | (6bR,10aS)-1,3,8-trihydroxy-10,10a-dihydro-6bH-[1]benzofuro[3,2-c]chromene-6,9-dione |
|---|---|
| PubChem CID | 162812240 |
| Molecular Formula | C15H10O7 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | (6bR,10aS)-1,3,8-trihydroxy-10,10a-dihydro-6bH-[1]benzofuro[3,2-c]chromene-6,9-dione |
| SMILES | O=C1C[C@@H]2Oc3c(c(=O)oc4cc(O)cc(O)c34)[C@H]2C=C1O |
| InChI | InChI=1S/C15H10O7/c16-5-1-9(19)13-11(2-5)22-15(20)12-6-3-7(17)8(18)4-10(6)21-14(12)13/h1-3,6,10,16-17,19H,4H2/t6-,10-/m0/s1 |
| InChIKey | UZXMPUBFBQEDBG-WKEGUHRASA-N |
| XLogP | 1.46 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|