C21H15N3O5 — CID 4222958
2-amino-4-[4-(cyanomethoxy)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carboxamide (PubChem CID 4222958) has the molecular formula C21H15N3O5 and a molecular weight of 389.37 g/mol. Its IUPAC name is 2-amino-4-[4-(cyanomethoxy)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carboxamide.
| Compound Name | 2-amino-4-[4-(cyanomethoxy)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carboxamide |
|---|---|
| PubChem CID | 4222958 |
| Molecular Formula | C21H15N3O5 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-amino-4-[4-(cyanomethoxy)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carboxamide |
| SMILES | N#CCOc1ccc(C2C(C(N)=O)=C(N)Oc3c2c(=O)oc2ccccc32)cc1 |
| InChI | InChI=1S/C21H15N3O5/c22-9-10-27-12-7-5-11(6-8-12)15-16-18(29-20(24)17(15)19(23)25)13-3-1-2-4-14(13)28-21(16)26/h1-8,15H,10,24H2,(H2,23,25) |
| InChIKey | KZKQUBDLYUAXAP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 141.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|