C21H18N2O5 — CID 25135611
(2S,7S,8S)-8-(4-nitrophenyl)-3,12-dioxa-9-azatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraen-11-one (PubChem CID 25135611) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is (2S,7S,8S)-8-(4-nitrophenyl)-3,12-dioxa-9-azatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraen-11-one.
| Compound Name | (2S,7S,8S)-8-(4-nitrophenyl)-3,12-dioxa-9-azatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraen-11-one |
|---|---|
| PubChem CID | 25135611 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (2S,7S,8S)-8-(4-nitrophenyl)-3,12-dioxa-9-azatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraen-11-one |
| SMILES | O=c1oc2ccccc2c2c1N[C@H](c1ccc([N+](=O)[O-])cc1)[C@@H]1CCCO[C@H]21 |
| InChI | InChI=1S/C21H18N2O5/c24-21-19-17(14-4-1-2-6-16(14)28-21)20-15(5-3-11-27-20)18(22-19)12-7-9-13(10-8-12)23(25)26/h1-2,4,6-10,15,18,20,22H,3,5,11H2/t15-,18+,20-/m0/s1 |
| InChIKey | VNZWJYVYZUSQTA-CVAIRZPRSA-N |
| XLogP | 4.34 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|