C22H22N6O6 — CID 23657517
4,8-bis(4-nitrophenyl)-3,4,4a,5,6,7,7a,8,9,11-decahydro-1H-pyrimido[5,4-i]quinazoline-2,10-dione (PubChem CID 23657517) has the molecular formula C22H22N6O6 and a molecular weight of 466.45 g/mol. Its IUPAC name is 4,8-bis(4-nitrophenyl)-3,4,4a,5,6,7,7a,8,9,11-decahydro-1H-pyrimido[5,4-i]quinazoline-2,10-dione.
| Compound Name | 4,8-bis(4-nitrophenyl)-3,4,4a,5,6,7,7a,8,9,11-decahydro-1H-pyrimido[5,4-i]quinazoline-2,10-dione |
|---|---|
| PubChem CID | 23657517 |
| Molecular Formula | C22H22N6O6 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 4,8-bis(4-nitrophenyl)-3,4,4a,5,6,7,7a,8,9,11-decahydro-1H-pyrimido[5,4-i]quinazoline-2,10-dione |
| SMILES | O=C1NC(c2ccc([N+](=O)[O-])cc2)C2CCCC3C(c4ccc([N+](=O)[O-])cc4)NC(=O)NC23N1 |
| InChI | InChI=1S/C22H22N6O6/c29-20-23-18(12-4-8-14(9-5-12)27(31)32)16-2-1-3-17-19(24-21(30)26-22(16,17)25-20)13-6-10-15(11-7-13)28(33)34/h4-11,16-19H,1-3H2,(H2,23,25,29)(H2,24,26,30) |
| InChIKey | IFLJLYAUKSKRFJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 168.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|