C17H13F3N4O5 — CID 4582541
4-hydroxy-6-(4-nitrophenyl)-5-(pyridine-2-carbonyl)-4-(trifluoromethyl)-1,3-diazinan-2-one (PubChem CID 4582541) has the molecular formula C17H13F3N4O5 and a molecular weight of 410.31 g/mol. Its IUPAC name is 4-hydroxy-6-(4-nitrophenyl)-5-(pyridine-2-carbonyl)-4-(trifluoromethyl)-1,3-diazinan-2-one.
| Compound Name | 4-hydroxy-6-(4-nitrophenyl)-5-(pyridine-2-carbonyl)-4-(trifluoromethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 4582541 |
| Molecular Formula | C17H13F3N4O5 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 4-hydroxy-6-(4-nitrophenyl)-5-(pyridine-2-carbonyl)-4-(trifluoromethyl)-1,3-diazinan-2-one |
| SMILES | O=C1NC(c2ccc([N+](=O)[O-])cc2)C(C(=O)c2ccccn2)C(O)(C(F)(F)F)N1 |
| InChI | InChI=1S/C17H13F3N4O5/c18-17(19,20)16(27)12(14(25)11-3-1-2-8-21-11)13(22-15(26)23-16)9-4-6-10(7-5-9)24(28)29/h1-8,12-13,27H,(H2,22,23,26) |
| InChIKey | TUVHGKFBTZZXMO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|