C15H11F3N4O6 — CID 7690008
(4R,5R,6S)-4-hydroxy-6-(5-nitrofuran-2-yl)-5-(pyridine-3-carbonyl)-4-(trifluoromethyl)-1,3-diazinan-2-one (PubChem CID 7690008) has the molecular formula C15H11F3N4O6 and a molecular weight of 400.27 g/mol. Its IUPAC name is (4R,5R,6S)-4-hydroxy-6-(5-nitrofuran-2-yl)-5-(pyridine-3-carbonyl)-4-(trifluoromethyl)-1,3-diazinan-2-one.
| Compound Name | (4R,5R,6S)-4-hydroxy-6-(5-nitrofuran-2-yl)-5-(pyridine-3-carbonyl)-4-(trifluoromethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 7690008 |
| Molecular Formula | C15H11F3N4O6 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | (4R,5R,6S)-4-hydroxy-6-(5-nitrofuran-2-yl)-5-(pyridine-3-carbonyl)-4-(trifluoromethyl)-1,3-diazinan-2-one |
| SMILES | O=C1N[C@H](c2ccc([N+](=O)[O-])o2)[C@@H](C(=O)c2cccnc2)[C@@](O)(C(F)(F)F)N1 |
| InChI | InChI=1S/C15H11F3N4O6/c16-15(17,18)14(25)10(12(23)7-2-1-5-19-6-7)11(20-13(24)21-14)8-3-4-9(28-8)22(26)27/h1-6,10-11,25H,(H2,20,21,24)/t10-,11+,14+/m0/s1 |
| InChIKey | OQYIMGREVYXFEF-MISXGVKJSA-N |
| XLogP | 1.69 |
| TPSA | 147.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|